C11H14F3N2O7S+ — CID 87200167
(4-carboxy-3-nitrophenyl)-trimethylazanium;trifluoromethanesulfonic acid (PubChem CID 87200167) has the molecular formula C11H14F3N2O7S+ and a molecular weight of 375.30 g/mol. Its IUPAC name is (4-carboxy-3-nitrophenyl)-trimethylazanium;trifluoromethanesulfonic acid.
| Compound Name | (4-carboxy-3-nitrophenyl)-trimethylazanium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87200167 |
| Molecular Formula | C11H14F3N2O7S+ |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (4-carboxy-3-nitrophenyl)-trimethylazanium;trifluoromethanesulfonic acid |
| SMILES | C[N+](C)(C)c1ccc(C(=O)O)c([N+](=O)[O-])c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H12N2O4.CHF3O3S/c1-12(2,3)7-4-5-8(10(13)14)9(6-7)11(15)16;2-1(3,4)8(5,6)7/h4-6H,1-3H3;(H,5,6,7)/p+1 |
| InChIKey | LOERVSBAHSORPC-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|