C12H12FNO4S — CID 114284588
2-fluoro-4-(2-methylbut-3-yn-2-ylsulfamoyl)benzoic acid (PubChem CID 114284588) has the molecular formula C12H12FNO4S and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-fluoro-4-(2-methylbut-3-yn-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-fluoro-4-(2-methylbut-3-yn-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114284588 |
| Molecular Formula | C12H12FNO4S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-fluoro-4-(2-methylbut-3-yn-2-ylsulfamoyl)benzoic acid |
| SMILES | C#CC(C)(C)NS(=O)(=O)c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C12H12FNO4S/c1-4-12(2,3)14-19(17,18)8-5-6-9(11(15)16)10(13)7-8/h1,5-7,14H,2-3H3,(H,15,16) |
| InChIKey | OJSHHNCKTXIWHY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|