C10H11F2NO4S — CID 61263772
2-[(3,4-difluorophenyl)sulfonylamino]-2-methylpropanoic acid (PubChem CID 61263772) has the molecular formula C10H11F2NO4S and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)sulfonylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(3,4-difluorophenyl)sulfonylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61263772 |
| Molecular Formula | C10H11F2NO4S |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-[(3,4-difluorophenyl)sulfonylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C10H11F2NO4S/c1-10(2,9(14)15)13-18(16,17)6-3-4-7(11)8(12)5-6/h3-5,13H,1-2H3,(H,14,15) |
| InChIKey | GXXJQJULXJGWLZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |