C12H16FNO4S — CID 39655364
methyl 2-[(3-fluoro-4-methylphenyl)sulfonylamino]-2-methylpropanoate (PubChem CID 39655364) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-[(3-fluoro-4-methylphenyl)sulfonylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[(3-fluoro-4-methylphenyl)sulfonylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 39655364 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | methyl 2-[(3-fluoro-4-methylphenyl)sulfonylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NS(=O)(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C12H16FNO4S/c1-8-5-6-9(7-10(8)13)19(16,17)14-12(2,3)11(15)18-4/h5-7,14H,1-4H3 |
| InChIKey | SMHRAOCEUZKOOZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |