C11H14FNO3S — CID 90818403
2-(3-fluoro-4-methylphenyl)sulfonyl-2-methylpropanamide (PubChem CID 90818403) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)sulfonyl-2-methylpropanamide.
| Compound Name | 2-(3-fluoro-4-methylphenyl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 90818403 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)sulfonyl-2-methylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)C(C)(C)C(N)=O)cc1F |
| InChI | InChI=1S/C11H14FNO3S/c1-7-4-5-8(6-9(7)12)17(15,16)11(2,3)10(13)14/h4-6H,1-3H3,(H2,13,14) |
| InChIKey | HJONHQWHQIUOFY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |