C9H11FN2O4S — CID 112673521
2-[(3-fluoro-4-methylphenyl)sulfonylamino]oxyacetamide (PubChem CID 112673521) has the molecular formula C9H11FN2O4S and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methylphenyl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(3-fluoro-4-methylphenyl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673521 |
| Molecular Formula | C9H11FN2O4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-[(3-fluoro-4-methylphenyl)sulfonylamino]oxyacetamide |
| SMILES | Cc1ccc(S(=O)(=O)NOCC(N)=O)cc1F |
| InChI | InChI=1S/C9H11FN2O4S/c1-6-2-3-7(4-8(6)10)17(14,15)12-16-5-9(11)13/h2-4,12H,5H2,1H3,(H2,11,13) |
| InChIKey | KUOKFEWGIVVVQY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|