C9H12N2O5S — CID 112673531
2-[(4-methoxyphenyl)sulfonylamino]oxyacetamide (PubChem CID 112673531) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(4-methoxyphenyl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673531 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonylamino]oxyacetamide |
| SMILES | COc1ccc(S(=O)(=O)NOCC(N)=O)cc1 |
| InChI | InChI=1S/C9H12N2O5S/c1-15-7-2-4-8(5-3-7)17(13,14)11-16-6-9(10)12/h2-5,11H,6H2,1H3,(H2,10,12) |
| InChIKey | SYCXQXOMMOPGCO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|