C10H11N3O6S — CID 113358305
2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]oxyacetamide (PubChem CID 113358305) has the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. Its IUPAC name is 2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 113358305 |
| Molecular Formula | C10H11N3O6S |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]oxyacetamide |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)NOCC(N)=O)ccc21 |
| InChI | InChI=1S/C10H11N3O6S/c1-13-7-3-2-6(4-8(7)19-10(13)15)20(16,17)12-18-5-9(11)14/h2-4,12H,5H2,1H3,(H2,11,14) |
| InChIKey | FTYKVWXMCUXOBJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|