C8H10N2O6S2 — CID 112673568
methyl 3-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-2-carboxylate (PubChem CID 112673568) has the molecular formula C8H10N2O6S2 and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 3-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 112673568 |
| Molecular Formula | C8H10N2O6S2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | methyl 3-[(2-amino-2-oxoethoxy)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NOCC(N)=O |
| InChI | InChI=1S/C8H10N2O6S2/c1-15-8(12)7-5(2-3-17-7)18(13,14)10-16-4-6(9)11/h2-3,10H,4H2,1H3,(H2,9,11) |
| InChIKey | VUYGKSJRNBFHJN-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|