C7H10N2O3S2 — CID 156531143
methyl 3-(S-amino-N-methylsulfonimidoyl)thiophene-2-carboxylate (PubChem CID 156531143) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is methyl 3-(S-amino-N-methylsulfonimidoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(S-amino-N-methylsulfonimidoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 156531143 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | methyl 3-(S-amino-N-methylsulfonimidoyl)thiophene-2-carboxylate |
| SMILES | CN=S(N)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C7H10N2O3S2/c1-9-14(8,11)5-3-4-13-6(5)7(10)12-2/h3-4H,1-2H3,(H2,8,9,11) |
| InChIKey | NUHAZEBLXKFYEN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |