C10H15NO5S2 — CID 3742759
methyl 3-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 3742759) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 3-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3742759 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | methyl 3-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COCCN(C)S(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C10H15NO5S2/c1-11(5-6-15-2)18(13,14)8-4-7-17-9(8)10(12)16-3/h4,7H,5-6H2,1-3H3 |
| InChIKey | NKOBJGHNKBKZHV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |