C12H13NO5S2 — CID 18148317
methyl 3-[furan-2-ylmethyl(methyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 18148317) has the molecular formula C12H13NO5S2 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 3-[furan-2-ylmethyl(methyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[furan-2-ylmethyl(methyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18148317 |
| Molecular Formula | C12H13NO5S2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | methyl 3-[furan-2-ylmethyl(methyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C12H13NO5S2/c1-13(8-9-4-3-6-18-9)20(15,16)10-5-7-19-11(10)12(14)17-2/h3-7H,8H2,1-2H3 |
| InChIKey | GJVWIHYGIPHNCF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |