C16H19NO4S2 — CID 47064918
methyl 3-[methyl(3-phenylpropyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 47064918) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is methyl 3-[methyl(3-phenylpropyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[methyl(3-phenylpropyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 47064918 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | methyl 3-[methyl(3-phenylpropyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N(C)CCCc1ccccc1 |
| InChI | InChI=1S/C16H19NO4S2/c1-17(11-6-9-13-7-4-3-5-8-13)23(19,20)14-10-12-22-15(14)16(18)21-2/h3-5,7-8,10,12H,6,9,11H2,1-2H3 |
| InChIKey | IPYMNXPMZNWWQZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |