C11H17NO4S2 — CID 43294757
3-[methyl(pentyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 43294757) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-[methyl(pentyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[methyl(pentyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43294757 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-[methyl(pentyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CCCCCN(C)S(=O)(=O)c1ccsc1C(=O)O |
| InChI | InChI=1S/C11H17NO4S2/c1-3-4-5-7-12(2)18(15,16)9-6-8-17-10(9)11(13)14/h6,8H,3-5,7H2,1-2H3,(H,13,14) |
| InChIKey | OTIKZNABXFXGOC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|