C13H21NO4S2 — CID 43145434
3-(dibutylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 43145434) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(dibutylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(dibutylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43145434 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-(dibutylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccsc1C(=O)O |
| InChI | InChI=1S/C13H21NO4S2/c1-3-5-8-14(9-6-4-2)20(17,18)11-7-10-19-12(11)13(15)16/h7,10H,3-6,8-9H2,1-2H3,(H,15,16) |
| InChIKey | OSZDWOKUQOVTJS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |