C5H5ClO5S2 — CID 174927942
3-sulfothiophene-2-carboxylic acid;hydrochloride (PubChem CID 174927942) has the molecular formula C5H5ClO5S2 and a molecular weight of 244.68 g/mol. Its IUPAC name is 3-sulfothiophene-2-carboxylic acid;hydrochloride.
| Compound Name | 3-sulfothiophene-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 174927942 |
| Molecular Formula | C5H5ClO5S2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | 3-sulfothiophene-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1sccc1S(=O)(=O)O |
| InChI | InChI=1S/C5H4O5S2.ClH/c6-5(7)4-3(1-2-11-4)12(8,9)10;/h1-2H,(H,6,7)(H,8,9,10);1H |
| InChIKey | HXBGQANRMYBGOX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|