C10H15NO4S2 — CID 61167041
3-(2,2-dimethylpropylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 61167041) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(2,2-dimethylpropylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61167041 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-(2,2-dimethylpropylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)CNS(=O)(=O)c1ccsc1C(=O)O |
| InChI | InChI=1S/C10H15NO4S2/c1-10(2,3)6-11-17(14,15)7-4-5-16-8(7)9(12)13/h4-5,11H,6H2,1-3H3,(H,12,13) |
| InChIKey | PDMMUMXMDHPSOU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |