C8H7F4NO4S2 — CID 114169173
3-(2,2,3,3-tetrafluoropropylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 114169173) has the molecular formula C8H7F4NO4S2 and a molecular weight of 321.27 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(2,2,3,3-tetrafluoropropylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114169173 |
| Molecular Formula | C8H7F4NO4S2 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H7F4NO4S2/c9-7(10)8(11,12)3-13-19(16,17)4-1-2-18-5(4)6(14)15/h1-2,7,13H,3H2,(H,14,15) |
| InChIKey | QPKILFUTYGBLFR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|