C8H6BrF4NO5S — CID 106290683
5-bromo-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid (PubChem CID 106290683) has the molecular formula C8H6BrF4NO5S and a molecular weight of 384.10 g/mol. Its IUPAC name is 5-bromo-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106290683 |
| Molecular Formula | C8H6BrF4NO5S |
| Molecular Weight | 384.10 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 5-bromo-4-(2,2,3,3-tetrafluoropropylsulfamoyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC(F)(F)C(F)F)c(Br)o1 |
| InChI | InChI=1S/C8H6BrF4NO5S/c9-5-4(1-3(19-5)6(15)16)20(17,18)14-2-8(12,13)7(10)11/h1,7,14H,2H2,(H,15,16) |
| InChIKey | VAYJHVIQGFSTHZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|