C9H11BrN2O6S — CID 62829535
4-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-5-bromofuran-2-carboxylic acid (PubChem CID 62829535) has the molecular formula C9H11BrN2O6S and a molecular weight of 355.17 g/mol. Its IUPAC name is 4-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-5-bromofuran-2-carboxylic acid.
| Compound Name | 4-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-5-bromofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 62829535 |
| Molecular Formula | C9H11BrN2O6S |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 4-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-5-bromofuran-2-carboxylic acid |
| SMILES | CC(C)(NS(=O)(=O)c1cc(C(=O)O)oc1Br)C(N)=O |
| InChI | InChI=1S/C9H11BrN2O6S/c1-9(2,8(11)15)12-19(16,17)5-3-4(7(13)14)18-6(5)10/h3,12H,1-2H3,(H2,11,15)(H,13,14) |
| InChIKey | CDRVGPLCVDBBPW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |