C10H14BrNO6S — CID 79253717
5-bromo-4-[(1-hydroxy-3-methylbutan-2-yl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 79253717) has the molecular formula C10H14BrNO6S and a molecular weight of 356.19 g/mol. Its IUPAC name is 5-bromo-4-[(1-hydroxy-3-methylbutan-2-yl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(1-hydroxy-3-methylbutan-2-yl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79253717 |
| Molecular Formula | C10H14BrNO6S |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 5-bromo-4-[(1-hydroxy-3-methylbutan-2-yl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | CC(C)C(CO)NS(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C10H14BrNO6S/c1-5(2)6(4-13)12-19(16,17)8-3-7(10(14)15)18-9(8)11/h3,5-6,12-13H,4H2,1-2H3,(H,14,15) |
| InChIKey | OGDYEYYUUQDGEL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |