C19H24BrNO5S — CID 166392198
5-bromo-4-[[1-(4-tert-butylphenyl)-2-methylpropyl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 166392198) has the molecular formula C19H24BrNO5S and a molecular weight of 458.37 g/mol. Its IUPAC name is 5-bromo-4-[[1-(4-tert-butylphenyl)-2-methylpropyl]sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[[1-(4-tert-butylphenyl)-2-methylpropyl]sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 166392198 |
| Molecular Formula | C19H24BrNO5S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 5-bromo-4-[[1-(4-tert-butylphenyl)-2-methylpropyl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | CC(C)C(NS(=O)(=O)c1cc(C(=O)O)oc1Br)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24BrNO5S/c1-11(2)16(12-6-8-13(9-7-12)19(3,4)5)21-27(24,25)15-10-14(18(22)23)26-17(15)20/h6-11,16,21H,1-5H3,(H,22,23) |
| InChIKey | RRUSBECNUFSYJO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |