C12H18BrNO5S — CID 63843662
5-bromo-4-(3-ethylpentan-2-ylsulfamoyl)furan-2-carboxylic acid (PubChem CID 63843662) has the molecular formula C12H18BrNO5S and a molecular weight of 368.25 g/mol. Its IUPAC name is 5-bromo-4-(3-ethylpentan-2-ylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-(3-ethylpentan-2-ylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63843662 |
| Molecular Formula | C12H18BrNO5S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 5-bromo-4-(3-ethylpentan-2-ylsulfamoyl)furan-2-carboxylic acid |
| SMILES | CCC(CC)C(C)NS(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C12H18BrNO5S/c1-4-8(5-2)7(3)14-20(17,18)10-6-9(12(15)16)19-11(10)13/h6-8,14H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | OGAHRGRMFCIJOB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |