C10H10BrNO5S — CID 113477046
5-bromo-4-(pent-4-yn-2-ylsulfamoyl)furan-2-carboxylic acid (PubChem CID 113477046) has the molecular formula C10H10BrNO5S and a molecular weight of 336.16 g/mol. Its IUPAC name is 5-bromo-4-(pent-4-yn-2-ylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-(pent-4-yn-2-ylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 113477046 |
| Molecular Formula | C10H10BrNO5S |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 5-bromo-4-(pent-4-yn-2-ylsulfamoyl)furan-2-carboxylic acid |
| SMILES | C#CCC(C)NS(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C10H10BrNO5S/c1-3-4-6(2)12-18(15,16)8-5-7(10(13)14)17-9(8)11/h1,5-6,12H,4H2,2H3,(H,13,14) |
| InChIKey | PDDALJSMDOYQBT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|