C10H15NO6S — CID 83177359
4-(4-hydroxybutan-2-ylsulfamoyl)-5-methylfuran-2-carboxylic acid (PubChem CID 83177359) has the molecular formula C10H15NO6S and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-(4-hydroxybutan-2-ylsulfamoyl)-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-(4-hydroxybutan-2-ylsulfamoyl)-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 83177359 |
| Molecular Formula | C10H15NO6S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-(4-hydroxybutan-2-ylsulfamoyl)-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)NC(C)CCO |
| InChI | InChI=1S/C10H15NO6S/c1-6(3-4-12)11-18(15,16)9-5-8(10(13)14)17-7(9)2/h5-6,11-12H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | ZXHFJEOYMWDZHE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |