C12H19NO6S — CID 106168460
4-[(1-hydroxy-3-methylpentan-3-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 106168460) has the molecular formula C12H19NO6S and a molecular weight of 305.35 g/mol. Its IUPAC name is 4-[(1-hydroxy-3-methylpentan-3-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(1-hydroxy-3-methylpentan-3-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 106168460 |
| Molecular Formula | C12H19NO6S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[(1-hydroxy-3-methylpentan-3-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CCC(C)(CCO)NS(=O)(=O)c1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C12H19NO6S/c1-4-12(3,5-6-14)13-20(17,18)10-7-9(11(15)16)19-8(10)2/h7,13-14H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | GDASFJBVIHHDAW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |