C10H15NO7S — CID 62805420
4-[2-(2-hydroxyethoxy)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 62805420) has the molecular formula C10H15NO7S and a molecular weight of 293.30 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 62805420 |
| Molecular Formula | C10H15NO7S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)NCCOCCO |
| InChI | InChI=1S/C10H15NO7S/c1-7-9(6-8(18-7)10(13)14)19(15,16)11-2-4-17-5-3-12/h6,11-12H,2-5H2,1H3,(H,13,14) |
| InChIKey | AGCCEYUBWQBMOD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|