C10H15NO6S2 — CID 113494489
4-(2-ethylsulfinylethylsulfamoyl)-5-methylfuran-2-carboxylic acid (PubChem CID 113494489) has the molecular formula C10H15NO6S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-(2-ethylsulfinylethylsulfamoyl)-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-(2-ethylsulfinylethylsulfamoyl)-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 113494489 |
| Molecular Formula | C10H15NO6S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 4-(2-ethylsulfinylethylsulfamoyl)-5-methylfuran-2-carboxylic acid |
| SMILES | CCS(=O)CCNS(=O)(=O)c1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C10H15NO6S2/c1-3-18(14)5-4-11-19(15,16)9-6-8(10(12)13)17-7(9)2/h6,11H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | SBMCSLBISYHEFL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |