C12H13NO6S — CID 62804693
4-[2-(furan-2-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 62804693) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-[2-(furan-2-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[2-(furan-2-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 62804693 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-[2-(furan-2-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)NCCc1ccco1 |
| InChI | InChI=1S/C12H13NO6S/c1-8-11(7-10(19-8)12(14)15)20(16,17)13-5-4-9-3-2-6-18-9/h2-3,6-7,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | SOUNIRIMQJDJQF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |