C11H13N3O5S — CID 65232447
4-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 65232447) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 65232447 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[2-(1H-imidazol-5-yl)ethylsulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C11H13N3O5S/c1-7-10(4-9(19-7)11(15)16)20(17,18)14-3-2-8-5-12-6-13-8/h4-6,14H,2-3H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | VERYTDNSSIYDCJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |