C13H13NO6S — CID 115778042
4-[[4-(hydroxymethyl)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 115778042) has the molecular formula C13H13NO6S and a molecular weight of 311.32 g/mol. Its IUPAC name is 4-[[4-(hydroxymethyl)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[[4-(hydroxymethyl)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 115778042 |
| Molecular Formula | C13H13NO6S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-[[4-(hydroxymethyl)phenyl]sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C13H13NO6S/c1-8-12(6-11(20-8)13(16)17)21(18,19)14-10-4-2-9(7-15)3-5-10/h2-6,14-15H,7H2,1H3,(H,16,17) |
| InChIKey | NJIBUSZAWIJGOP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |