C12H9BrFNO5S — CID 71867044
4-[(3-bromo-5-fluorophenyl)sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 71867044) has the molecular formula C12H9BrFNO5S and a molecular weight of 378.18 g/mol. Its IUPAC name is 4-[(3-bromo-5-fluorophenyl)sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(3-bromo-5-fluorophenyl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 71867044 |
| Molecular Formula | C12H9BrFNO5S |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | 4-[(3-bromo-5-fluorophenyl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)Nc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C12H9BrFNO5S/c1-6-11(5-10(20-6)12(16)17)21(18,19)15-9-3-7(13)2-8(14)4-9/h2-5,15H,1H3,(H,16,17) |
| InChIKey | AHKUZOFYNFKEEL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |