C11H13N3O5S — CID 104617678
4-[(4-ethyl-1H-pyrazol-5-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 104617678) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-[(4-ethyl-1H-pyrazol-5-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(4-ethyl-1H-pyrazol-5-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 104617678 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[(4-ethyl-1H-pyrazol-5-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CCc1cn[nH]c1NS(=O)(=O)c1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C11H13N3O5S/c1-3-7-5-12-13-10(7)14-20(17,18)9-4-8(11(15)16)19-6(9)2/h4-5H,3H2,1-2H3,(H,15,16)(H2,12,13,14) |
| InChIKey | FENPWUATRRQHJP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |