C13H21NO6S — CID 103223772
4-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103223772) has the molecular formula C13H21NO6S and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103223772 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CCOCC(NS(=O)(=O)c1cc(C(=O)O)oc1C)C(C)C |
| InChI | InChI=1S/C13H21NO6S/c1-5-19-7-10(8(2)3)14-21(17,18)12-6-11(13(15)16)20-9(12)4/h6,8,10,14H,5,7H2,1-4H3,(H,15,16) |
| InChIKey | ZRTHQECDFNRICJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |