C9H12N2O6S — CID 55119920
4-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 55119920) has the molecular formula C9H12N2O6S and a molecular weight of 276.27 g/mol. Its IUPAC name is 4-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 55119920 |
| Molecular Formula | C9H12N2O6S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 4-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)NC(C)C(N)=O |
| InChI | InChI=1S/C9H12N2O6S/c1-4(8(10)12)11-18(15,16)7-3-6(9(13)14)17-5(7)2/h3-4,11H,1-2H3,(H2,10,12)(H,13,14) |
| InChIKey | GYEOFLYHOAPQAR-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |