C11H13BrN2O5S — CID 81488673
3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-bromo-4-methylbenzoic acid (PubChem CID 81488673) has the molecular formula C11H13BrN2O5S and a molecular weight of 365.21 g/mol. Its IUPAC name is 3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-bromo-4-methylbenzoic acid.
| Compound Name | 3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-bromo-4-methylbenzoic acid |
|---|---|
| PubChem CID | 81488673 |
| Molecular Formula | C11H13BrN2O5S |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-5-bromo-4-methylbenzoic acid |
| SMILES | Cc1c(Br)cc(C(=O)O)cc1S(=O)(=O)NC(C)C(N)=O |
| InChI | InChI=1S/C11H13BrN2O5S/c1-5-8(12)3-7(11(16)17)4-9(5)20(18,19)14-6(2)10(13)15/h3-4,6,14H,1-2H3,(H2,13,15)(H,16,17) |
| InChIKey | RAANOQRERNKKDF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |