C12H11F2NO4S — CID 105115703
3,4-difluoro-5-(pent-4-yn-2-ylsulfamoyl)benzoic acid (PubChem CID 105115703) has the molecular formula C12H11F2NO4S and a molecular weight of 303.29 g/mol. Its IUPAC name is 3,4-difluoro-5-(pent-4-yn-2-ylsulfamoyl)benzoic acid.
| Compound Name | 3,4-difluoro-5-(pent-4-yn-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 105115703 |
| Molecular Formula | C12H11F2NO4S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3,4-difluoro-5-(pent-4-yn-2-ylsulfamoyl)benzoic acid |
| SMILES | C#CCC(C)NS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C12H11F2NO4S/c1-3-4-7(2)15-20(18,19)10-6-8(12(16)17)5-9(13)11(10)14/h1,5-7,15H,4H2,2H3,(H,16,17) |
| InChIKey | AVOTZNRPBYBABH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|