C11H13F2NO5S — CID 107216179
3,4-difluoro-5-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]benzoic acid (PubChem CID 107216179) has the molecular formula C11H13F2NO5S and a molecular weight of 309.29 g/mol. Its IUPAC name is 3,4-difluoro-5-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 3,4-difluoro-5-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 107216179 |
| Molecular Formula | C11H13F2NO5S |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3,4-difluoro-5-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]benzoic acid |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1cc(C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C11H13F2NO5S/c1-2-7(5-15)14-20(18,19)9-4-6(11(16)17)3-8(12)10(9)13/h3-4,7,14-15H,2,5H2,1H3,(H,16,17)/t7-/m1/s1 |
| InChIKey | LHXPAIKKOIMLJJ-SSDOTTSWSA-N |
| XLogP | 0.71 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |