C9H12F2N2O4S — CID 65310162
5-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-difluorobenzenesulfonamide (PubChem CID 65310162) has the molecular formula C9H12F2N2O4S and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-difluorobenzenesulfonamide.
| Compound Name | 5-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 65310162 |
| Molecular Formula | C9H12F2N2O4S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5-amino-N-(1,3-dihydroxypropan-2-yl)-2,3-difluorobenzenesulfonamide |
| SMILES | Nc1cc(F)c(F)c(S(=O)(=O)NC(CO)CO)c1 |
| InChI | InChI=1S/C9H12F2N2O4S/c10-7-1-5(12)2-8(9(7)11)18(16,17)13-6(3-14)4-15/h1-2,6,13-15H,3-4,12H2 |
| InChIKey | YAVAMWSXTMPGIF-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|