C12H17NO6S — CID 43416589
3-(1-hydroxybutan-2-ylsulfamoyl)-4-methoxybenzoic acid (PubChem CID 43416589) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-(1-hydroxybutan-2-ylsulfamoyl)-4-methoxybenzoic acid.
| Compound Name | 3-(1-hydroxybutan-2-ylsulfamoyl)-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 43416589 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-(1-hydroxybutan-2-ylsulfamoyl)-4-methoxybenzoic acid |
| SMILES | CCC(CO)NS(=O)(=O)c1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C12H17NO6S/c1-3-9(7-14)13-20(17,18)11-6-8(12(15)16)4-5-10(11)19-2/h4-6,9,13-14H,3,7H2,1-2H3,(H,15,16) |
| InChIKey | FPHSRZZDVYEKTD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |