C12H19NO5S — CID 51697625
N-[(2R)-1-hydroxybutan-2-yl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 51697625) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[(2R)-1-hydroxybutan-2-yl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(2R)-1-hydroxybutan-2-yl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 51697625 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(2R)-1-hydroxybutan-2-yl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO5S/c1-4-9(8-14)13-19(15,16)10-5-6-11(17-2)12(7-10)18-3/h5-7,9,13-14H,4,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | GCHBMZSWEKZKKZ-SECBINFHSA-N |
| XLogP | 0.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |