C22H26N2O8S2 — CID 4568672
2-N,6-N-bis(1-hydroxybutan-2-yl)-9,10-dioxoanthracene-2,6-disulfonamide (PubChem CID 4568672) has the molecular formula C22H26N2O8S2 and a molecular weight of 510.59 g/mol. Its IUPAC name is 2-N,6-N-bis(1-hydroxybutan-2-yl)-9,10-dioxoanthracene-2,6-disulfonamide.
| Compound Name | 2-N,6-N-bis(1-hydroxybutan-2-yl)-9,10-dioxoanthracene-2,6-disulfonamide |
|---|---|
| PubChem CID | 4568672 |
| Molecular Formula | C22H26N2O8S2 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-N,6-N-bis(1-hydroxybutan-2-yl)-9,10-dioxoanthracene-2,6-disulfonamide |
| SMILES | CCC(CO)NS(=O)(=O)c1ccc2c(c1)C(=O)c1ccc(S(=O)(=O)NC(CC)CO)cc1C2=O |
| InChI | InChI=1S/C22H26N2O8S2/c1-3-13(11-25)23-33(29,30)15-5-7-17-19(9-15)21(27)18-8-6-16(10-20(18)22(17)28)34(31,32)24-14(4-2)12-26/h5-10,13-14,23-26H,3-4,11-12H2,1-2H3 |
| InChIKey | SQQGZAWQHKPELJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|