C14H21NO5S — CID 20649447
3,4-dimethoxy-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]benzenesulfonamide (PubChem CID 20649447) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 20649447 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3,4-dimethoxy-N-[(2S,3S)-3-methyl-1-oxopentan-2-yl]benzenesulfonamide |
| SMILES | CC[C@H](C)[C@@H](C=O)NS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H21NO5S/c1-5-10(2)12(9-16)15-21(17,18)11-6-7-13(19-3)14(8-11)20-4/h6-10,12,15H,5H2,1-4H3/t10-,12+/m0/s1 |
| InChIKey | UXVLHNYDBAFCLZ-CMPLNLGQSA-N |
| XLogP | 1.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|