C14H17NO5S — CID 8817788
N-[(1S)-1-(furan-2-yl)ethyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 8817788) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 8817788 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)c2ccco2)cc1OC |
| InChI | InChI=1S/C14H17NO5S/c1-10(12-5-4-8-20-12)15-21(16,17)11-6-7-13(18-2)14(9-11)19-3/h4-10,15H,1-3H3/t10-/m0/s1 |
| InChIKey | IRACZFASUBIZNI-JTQLQIEISA-N |
| XLogP | 2.34 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |