C13H13NO5S — CID 110731592
N-[1-(furan-2-yl)ethyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110731592) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[1-(furan-2-yl)ethyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110731592 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc2c(c1)OCO2)c1ccco1 |
| InChI | InChI=1S/C13H13NO5S/c1-9(11-3-2-6-17-11)14-20(15,16)10-4-5-12-13(7-10)19-8-18-12/h2-7,9,14H,8H2,1H3 |
| InChIKey | ZATURVYYQKBTSC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |