C12H15N3O3S — CID 62147836
N-[1-(furan-2-yl)ethyl]-6-(methylamino)pyridine-3-sulfonamide (PubChem CID 62147836) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-6-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-[1-(furan-2-yl)ethyl]-6-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62147836 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-6-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)NC(C)c2ccco2)cn1 |
| InChI | InChI=1S/C12H15N3O3S/c1-9(11-4-3-7-18-11)15-19(16,17)10-5-6-12(13-2)14-8-10/h3-9,15H,1-2H3,(H,13,14) |
| InChIKey | FVNILRGYOBGPPB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |