C15H21N3O4S — CID 56725241
N-(2-butan-2-ylpyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 56725241) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(2-butan-2-ylpyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-butan-2-ylpyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 56725241 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(2-butan-2-ylpyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | CCC(C)n1nccc1NS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O4S/c1-5-11(2)18-15(8-9-16-18)17-23(19,20)12-6-7-13(21-3)14(10-12)22-4/h6-11,17H,5H2,1-4H3 |
| InChIKey | WMASRXRNEPCYDT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |