C15H18N2O4S — CID 2812403
N-(4-ethyl-2-pyridinyl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 2812403) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-(4-ethyl-2-pyridinyl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(4-ethyl-2-pyridinyl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2812403 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(4-ethyl-2-pyridinyl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | CCc1ccnc(NS(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C15H18N2O4S/c1-4-11-7-8-16-15(9-11)17-22(18,19)12-5-6-13(20-2)14(10-12)21-3/h5-10H,4H2,1-3H3,(H,16,17) |
| InChIKey | IGBRZUQLIAKIMY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |