C12H10Br2N2O3S — CID 102671955
3-bromo-N-(4-bromo-2-pyridinyl)-4-methoxybenzenesulfonamide (PubChem CID 102671955) has the molecular formula C12H10Br2N2O3S and a molecular weight of 422.10 g/mol. Its IUPAC name is 3-bromo-N-(4-bromo-2-pyridinyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-bromo-N-(4-bromo-2-pyridinyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 102671955 |
| Molecular Formula | C12H10Br2N2O3S |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 419.88 |
| IUPAC Name | 3-bromo-N-(4-bromo-2-pyridinyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(Br)ccn2)cc1Br |
| InChI | InChI=1S/C12H10Br2N2O3S/c1-19-11-3-2-9(7-10(11)14)20(17,18)16-12-6-8(13)4-5-15-12/h2-7H,1H3,(H,15,16) |
| InChIKey | KYXILVHOBPMPFI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |