C15H21N3O4S — CID 3256250
N-(5-tert-butyl-1H-pyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 3256250) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(5-tert-butyl-1H-pyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3256250 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(C(C)(C)C)[nH]n2)cc1OC |
| InChI | InChI=1S/C15H21N3O4S/c1-15(2,3)13-9-14(17-16-13)18-23(19,20)10-6-7-11(21-4)12(8-10)22-5/h6-9H,1-5H3,(H2,16,17,18) |
| InChIKey | AOTBLFPCZSMLBA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |